# Plot method for chent objects Plot method for chent objects ## Usage ``` r # S3 method for class 'chent' plot(x, ...) ``` ## Arguments - x: The chent object to be plotted - ...: Further arguments passed to [grImport::grid.picture](https://rdrr.io/pkg/grImport/man/grid.picture.html) ## Examples ``` r # Don't run examples per default, as PubChem may be unavailable # \dontrun{ caffeine <- chent$new("caffeine") #> Querying PubChem for name caffeine ... #> Get chemical information from RDKit using PubChem SMILES #> CN1C=NC2=C1C(=O)N(C(=O)N2C)C print(caffeine) #> #> Identifier $identifier caffeine #> InChI Key $inchikey RYYVLZVUVIJVGH-UHFFFAOYSA-N #> SMILES string $smiles: #> PubChem #> "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" #> Molecular weight $mw: 194.2 #> PubChem synonyms (up to 10): #> [1] "caffeine" "58-08-2" #> [3] "Guaranine" "1,3,7-Trimethylxanthine" #> [5] "Methyltheobromine" "Theine" #> [7] "Thein" "Cafeina" #> [9] "Caffein" "Cafipel" if (!is.null(caffeine$Picture)) { plot(caffeine) } # } ```