diff options
Diffstat (limited to 'docs/reference/chent.md')
| -rw-r--r-- | docs/reference/chent.md | 802 |
1 files changed, 802 insertions, 0 deletions
diff --git a/docs/reference/chent.md b/docs/reference/chent.md new file mode 100644 index 0000000..40716ce --- /dev/null +++ b/docs/reference/chent.md @@ -0,0 +1,802 @@ +# An R6 class for chemical entities with associated data + +The class is initialised with an identifier. Chemical information is +retrieved from the internet. Additionally, it can be generated using +RDKit if RDKit and its python bindings are installed. + +## Format + +An [R6::R6Class](https://r6.r-lib.org/reference/R6Class.html) generator +object + +## Public fields + +- `identifier`: + + (`character(1)`) + The identifier that was used to initiate the object, with attribute + 'source' + +- `inchikey`: + + (`character(1)`) + InChI Key, with attribute 'source' + +- `smiles`: + + ([`character()`](https://rdrr.io/r/base/character.html)) + SMILES code(s), with attribute 'source' + +- `mw`: + + (`numeric(1)`) + Molecular weight, with attribute 'source' + +- `pubchem`: + + ([`list()`](https://rdrr.io/r/base/list.html)) + List of information retrieved from PubChem + +- `rdkit`: + + List of information obtained with RDKit + +- `mol`: + + \<rdkit.Chem.rdchem.Mol\> object + +- `svg`: + + SVG code + +- `Picture`: + + Graph as a + [grImport::Picture](https://rdrr.io/pkg/grImport/man/Picture-class.html) + object obtained using the grImport package + +- `Pict_font_size`: + + Font size as extracted from the intermediate PostScript file + +- `pdf_height`: + + Height of the MediaBox in the pdf after cropping + +- `p0`: + + Vapour pressure in Pa + +- `cwsat`: + + Water solubility in mg/L + +- `PUF`: + + Plant uptake factor + +- `chyaml`: + + List of information obtained from a YAML file + +- `TPs`: + + List of transformation products as chent objects + +- `transformations`: + + Data frame of observed transformations + +- `soil_degradation`: + + Dataframe of modelling DT50 values + +- `soil_ff`: + + Dataframe of formation fractions + +- `soil_sorption`: + + Dataframe of soil sorption data + +## Methods + +### Public methods + +- [`chent$new()`](#method-chent-new) + +- [`chent$try_pubchem()`](#method-chent-try_pubchem) + +- [`chent$get_pubchem()`](#method-chent-get_pubchem) + +- [`chent$get_rdkit()`](#method-chent-get_rdkit) + +- [`chent$get_chyaml()`](#method-chent-get_chyaml) + +- [`chent$add_p0()`](#method-chent-add_p0) + +- [`chent$add_cwsat()`](#method-chent-add_cwsat) + +- [`chent$add_PUF()`](#method-chent-add_PUF) + +- [`chent$add_TP()`](#method-chent-add_TP) + +- [`chent$add_transformation()`](#method-chent-add_transformation) + +- [`chent$add_soil_degradation()`](#method-chent-add_soil_degradation) + +- [`chent$add_soil_ff()`](#method-chent-add_soil_ff) + +- [`chent$add_soil_sorption()`](#method-chent-add_soil_sorption) + +- [`chent$pdf()`](#method-chent-pdf) + +- [`chent$png()`](#method-chent-png) + +- [`chent$emf()`](#method-chent-emf) + +- [`chent$clone()`](#method-chent-clone) + +------------------------------------------------------------------------ + +### Method `new()` + +Creates a new instance of this +[R6](https://r6.r-lib.org/reference/R6Class.html) class. + +#### Usage + + chent$new( + identifier, + smiles = NULL, + inchikey = NULL, + pubchem = TRUE, + pubchem_from = c("name", "smiles", "inchikey"), + rdkit = TRUE, + template = NULL, + chyaml = FALSE + ) + +#### Arguments + +- `identifier`: + + Identifier to be stored in the object + +- `smiles`: + + Optional user provided SMILES code + +- `inchikey`: + + Optional user provided InChI Key + +- `pubchem`: + + Should an attempt be made to retrieve chemical information from + PubChem via the webchem package? + +- `pubchem_from`: + + Possibility to select the argument that is used to query pubchem + +- `rdkit`: + + Should an attempt be made to retrieve chemical information from a + local rdkit installation via python and the reticulate package? + +- `template`: + + An optional SMILES code to be used as template for RDKit + +- `chyaml`: + + Should we look for a identifier.yaml file in the working directory? + +------------------------------------------------------------------------ + +### Method `try_pubchem()` + +Try to get chemical information from PubChem + +#### Usage + + chent$try_pubchem(query = self$identifier, from = "name") + +#### Arguments + +- `query`: + + Query string to be passed to + [get_cid](https://docs.ropensci.org/webchem/reference/get_cid.html) + +- `from`: + + Passed to + [get_cid](https://docs.ropensci.org/webchem/reference/get_cid.html) + +------------------------------------------------------------------------ + +### Method `get_pubchem()` + +Get chemical information from PubChem for a known PubChem CID + +#### Usage + + chent$get_pubchem(pubchem_cid) + +#### Arguments + +- `pubchem_cid`: + + CID + +------------------------------------------------------------------------ + +### Method `get_rdkit()` + +Get chemical information from RDKit if available + +#### Usage + + chent$get_rdkit(template = NULL) + +#### Arguments + +- `template`: + + An optional SMILES code to be used as template for RDKit + +------------------------------------------------------------------------ + +### Method `get_chyaml()` + +Obtain information from a YAML file + +#### Usage + + chent$get_chyaml( + repo = c("wd", "local", "web"), + chyaml = paste0(URLencode(self$identifier), ".yaml") + ) + +#### Arguments + +- `repo`: + + Should the file be looked for in the current working directory, a + local git repository under `~/git/chyaml`, or from the web (not + implemented). + +- `chyaml`: + + The filename to be looked for + +------------------------------------------------------------------------ + +### Method `add_p0()` + +Add a vapour pressure + +#### Usage + + chent$add_p0(p0, T = NA, source = NA, page = NA, remark = "") + +#### Arguments + +- `p0`: + + The vapour pressure in Pa + +- `T`: + + Temperature + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +- `remark`: + + A remark + +------------------------------------------------------------------------ + +### Method `add_cwsat()` + +Add a water solubility + +#### Usage + + chent$add_cwsat(cwsat, T = NA, pH = NA, source = NA, page = NA, remark = "") + +#### Arguments + +- `cwsat`: + + The water solubility in mg/L + +- `T`: + + Temperature + +- `pH`: + + pH value + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +- `remark`: + + A remark + +------------------------------------------------------------------------ + +### Method `add_PUF()` + +Add a plant uptake factor + +#### Usage + + chent$add_PUF( + PUF = 0, + source = "focus_generic_gw_2014", + page = 41, + remark = "Conservative default value" + ) + +#### Arguments + +- `PUF`: + + The plant uptake factor, a number between 0 and 1 + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +- `remark`: + + A remark + +------------------------------------------------------------------------ + +### Method `add_TP()` + +Add a transformation product to the internal list + +#### Usage + + chent$add_TP(x, smiles = NULL, pubchem = FALSE) + +#### Arguments + +- `x`: + + A chent object, or an identifier to generate a chent object + +- `smiles`: + + Optional user provided SMILES code + +- `pubchem`: + + Should chemical information be obtained from PubChem? + +------------------------------------------------------------------------ + +### Method `add_transformation()` + +Add a line in the internal dataframe holding observed transformations + +#### Usage + + chent$add_transformation( + study_type, + TP_identifier, + max_occurrence, + remark = "", + source = NA, + pages = NA + ) + +#### Arguments + +- `study_type`: + + A characterisation of the study type + +- `TP_identifier`: + + An identifier of one of the transformation products in `self$TPs` + +- `max_occurrence`: + + The maximum observed occurrence of the transformation product, + expressed as a fraction of the amount that would result from + stochiometric transformation + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `pages`: + + The pages from which the information was taken + +------------------------------------------------------------------------ + +### Method `add_soil_degradation()` + +Add a line in the internal dataframe holding modelling DT50 values + +#### Usage + + chent$add_soil_degradation( + soils, + DT50_mod, + DT50_mod_ref, + type = NA, + country = NA, + pH_orig = NA, + pH_medium = NA, + pH_H2O = NA, + perc_OC = NA, + temperature = NA, + moisture = NA, + category = "lab", + formulation = NA, + model = NA, + chi2 = NA, + remark = "", + source, + page = NA + ) + +#### Arguments + +- `soils`: + + Names of the soils + +- `DT50_mod`: + + The modelling DT50 in the sense of regulatory pesticide fate modelling + +- `DT50_mod_ref`: + + The normalised modelling DT50 in the sense of regulatory pesticide + fate modelling + +- `type`: + + The soil type + +- `country`: + + The country (mainly for field studies) + +- `pH_orig`: + + The pH stated in the study + +- `pH_medium`: + + The medium in which this pH was measured + +- `pH_H2O`: + + The pH extrapolated to pure water + +- `perc_OC`: + + The percentage of organic carbon in the soil + +- `temperature`: + + The temperature during the study in degrees Celsius + +- `moisture`: + + The moisture during the study + +- `category`: + + Is it a laboratory ('lab') or field study ('field') + +- `formulation`: + + Name of the formulation applied, if it was not the technical active + ingredient + +- `model`: + + The degradation model used for deriving `DT50_mod` + +- `chi2`: + + The relative error as defined in FOCUS kinetics + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +------------------------------------------------------------------------ + +### Method `add_soil_ff()` + +Add one or more formation fractions for degradation in soil + +#### Usage + + chent$add_soil_ff(target, soils, ff = 1, remark = "", source, page = NA) + +#### Arguments + +- `target`: + + The identifier(s) of the transformation product + +- `soils`: + + The soil name(s) in which the transformation was observed + +- `ff`: + + The formation fraction(s) + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +------------------------------------------------------------------------ + +### Method `add_soil_sorption()` + +Add soil sorption data + +#### Usage + + chent$add_soil_sorption( + soils, + Kf, + Kfoc, + N, + type = NA, + pH_orig = NA, + pH_medium = NA, + pH_H2O = NA, + perc_OC = NA, + perc_clay = NA, + CEC = NA, + remark = "", + source, + page = NA + ) + +#### Arguments + +- `soils`: + + Names of the soils + +- `Kf`: + + The sorption constant in L/kg, either linear (then `N` is 1) or + according to Freundlich + +- `Kfoc`: + + The constant from above, normalised to soil organic carbon + +- `N`: + + The Freundlich exponent + +- `type`: + + The soil type + +- `pH_orig`: + + The pH stated in the study + +- `pH_medium`: + + The medium in which this pH was measured + +- `pH_H2O`: + + The pH extrapolated to pure water + +- `perc_OC`: + + The percentage of organic carbon in the soil + +- `perc_clay`: + + The percentage of clay in the soil + +- `CEC`: + + The cation exchange capacity + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +------------------------------------------------------------------------ + +### Method [`pdf()`](https://rdrr.io/r/grDevices/pdf.html) + +Write a PDF image of the structure + +#### Usage + + chent$pdf( + file = paste0(self$identifier, ".pdf"), + dir = "structures/pdf", + template = NULL + ) + +#### Arguments + +- `file`: + + The file to write to + +- `dir`: + + The directory to write the file to + +- `template`: + + An optional SMILES code to be used as template for RDKit + +------------------------------------------------------------------------ + +### Method [`png()`](https://rdrr.io/r/grDevices/png.html) + +Write a PNG image of the structure + +#### Usage + + chent$png( + file = paste0(self$identifier, ".png"), + dir = "structures/png", + antialias = "gray" + ) + +#### Arguments + +- `file`: + + The file to write to + +- `dir`: + + The directory to write the file to + +- `antialias`: + + Passed to [png](https://rdrr.io/r/grDevices/png.html) + +------------------------------------------------------------------------ + +### Method `emf()` + +Write an EMF image of the structure using +[emf](https://rdrr.io/pkg/devEMF/man/emf.html) + +#### Usage + + chent$emf(file = paste0(self$identifier, ".emf"), dir = "structures/emf") + +#### Arguments + +- `file`: + + The file to write to + +- `dir`: + + The directory to write the file to + +------------------------------------------------------------------------ + +### Method `clone()` + +The objects of this class are cloneable with this method. + +#### Usage + + chent$clone(deep = FALSE) + +#### Arguments + +- `deep`: + + Whether to make a deep clone. + +## Examples + +``` r +# Don't run examples per default, as PubChem may be unavailable +# \dontrun{ +caffeine <- chent$new("caffeine") +#> Querying PubChem for name caffeine ... +#> Get chemical information from RDKit using PubChem SMILES +#> CN1C=NC2=C1C(=O)N(C(=O)N2C)C +print(caffeine) +#> <chent> +#> Identifier $identifier caffeine +#> InChI Key $inchikey RYYVLZVUVIJVGH-UHFFFAOYSA-N +#> SMILES string $smiles: +#> PubChem +#> "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" +#> Molecular weight $mw: 194.2 +#> PubChem synonyms (up to 10): +#> [1] "caffeine" "58-08-2" +#> [3] "Guaranine" "1,3,7-Trimethylxanthine" +#> [5] "Methyltheobromine" "Theine" +#> [7] "Thein" "Cafeina" +#> [9] "Caffein" "Cafipel" +if (!is.null(caffeine$Picture)) { + plot(caffeine) +} + +oct <- chent$new("1-octanol", smiles = "CCCCCCCCO", pubchem = FALSE) +#> Get chemical information from RDKit using user SMILES +#> CCCCCCCCO +print(oct) +#> <chent> +#> Identifier $identifier 1-octanol +#> InChI Key $inchikey NA +#> SMILES string $smiles: +#> user +#> "CCCCCCCCO" +#> Molecular weight $mw: 130.2 +# } +``` |
