diff options
Diffstat (limited to 'docs/reference')
| -rw-r--r-- | docs/reference/chent.html | 11 | ||||
| -rw-r--r-- | docs/reference/chent.md | 802 | ||||
| -rw-r--r-- | docs/reference/draw_svg.chent.md | 37 | ||||
| -rw-r--r-- | docs/reference/index.html | 26 | ||||
| -rw-r--r-- | docs/reference/index.md | 20 | ||||
| -rw-r--r-- | docs/reference/pai.html | 7 | ||||
| -rw-r--r-- | docs/reference/pai.md | 187 | ||||
| -rw-r--r-- | docs/reference/plot.chent.html | 15 | ||||
| -rw-r--r-- | docs/reference/plot.chent.md | 51 | ||||
| -rw-r--r-- | docs/reference/ppp.md | 102 | ||||
| -rw-r--r-- | docs/reference/print.chent.md | 20 | ||||
| -rw-r--r-- | docs/reference/print.pai.md | 20 | ||||
| -rw-r--r-- | docs/reference/print.ppp.md | 20 |
13 files changed, 1296 insertions, 22 deletions
diff --git a/docs/reference/chent.html b/docs/reference/chent.html index 131d548..e2f241d 100644 --- a/docs/reference/chent.html +++ b/docs/reference/chent.html @@ -11,7 +11,7 @@ generated using RDKit if RDKit and its python bindings are installed."></head><b <a class="navbar-brand me-2" href="../index.html">chents</a> - <small class="nav-text text-muted me-auto" data-bs-toggle="tooltip" data-bs-placement="bottom" title="">0.4.0</small> + <small class="nav-text text-muted me-auto" data-bs-toggle="tooltip" data-bs-placement="bottom" title="">0.4.1</small> <button class="navbar-toggler" type="button" data-bs-toggle="collapse" data-bs-target="#navbar" aria-controls="navbar" aria-expanded="false" aria-label="Toggle navigation"> @@ -790,7 +790,9 @@ or according to Freundlich</p></dd> <div class="section level2"> <h2 id="ref-examples">Examples<a class="anchor" aria-label="anchor" href="#ref-examples"></a></h2> - <div class="sourceCode"><pre class="sourceCode r"><code><span class="r-in"><span><span class="va">caffeine</span> <span class="op"><-</span> <span class="va">chent</span><span class="op">$</span><span class="fu">new</span><span class="op">(</span><span class="st">"caffeine"</span><span class="op">)</span></span></span> + <div class="sourceCode"><pre class="sourceCode r"><code><span class="r-in"><span><span class="co"># Don't run examples per default, as PubChem may be unavailable</span></span></span> +<span class="r-in"><span><span class="co"># \dontrun{</span></span></span> +<span class="r-in"><span><span class="va">caffeine</span> <span class="op"><-</span> <span class="va">chent</span><span class="op">$</span><span class="fu">new</span><span class="op">(</span><span class="st">"caffeine"</span><span class="op">)</span></span></span> <span class="r-msg co"><span class="r-pr">#></span> Querying PubChem for name caffeine ...</span> <span class="r-msg co"><span class="r-pr">#></span> Get chemical information from RDKit using PubChem SMILES</span> <span class="r-msg co"><span class="r-pr">#></span> CN1C=NC2=C1C(=O)N(C(=O)N2C)C</span> @@ -807,7 +809,7 @@ or according to Freundlich</p></dd> <span class="r-out co"><span class="r-pr">#></span> [3] "Guaranine" "1,3,7-Trimethylxanthine"</span> <span class="r-out co"><span class="r-pr">#></span> [5] "Methyltheobromine" "Theine" </span> <span class="r-out co"><span class="r-pr">#></span> [7] "Thein" "Cafeina" </span> -<span class="r-out co"><span class="r-pr">#></span> [9] "Koffein" "Mateina" </span> +<span class="r-out co"><span class="r-pr">#></span> [9] "Caffein" "Cafipel" </span> <span class="r-in"><span><span class="kw">if</span> <span class="op">(</span><span class="op">!</span><span class="fu"><a href="https://rdrr.io/r/base/NULL.html" class="external-link">is.null</a></span><span class="op">(</span><span class="va">caffeine</span><span class="op">$</span><span class="va">Picture</span><span class="op">)</span><span class="op">)</span> <span class="op">{</span></span></span> <span class="r-in"><span> <span class="fu"><a href="https://rdrr.io/r/graphics/plot.default.html" class="external-link">plot</a></span><span class="op">(</span><span class="va">caffeine</span><span class="op">)</span></span></span> <span class="r-in"><span><span class="op">}</span></span></span> @@ -823,6 +825,7 @@ or according to Freundlich</p></dd> <span class="r-out co"><span class="r-pr">#></span> user </span> <span class="r-out co"><span class="r-pr">#></span> "CCCCCCCCO" </span> <span class="r-out co"><span class="r-pr">#></span> Molecular weight $mw: 130.2 </span> +<span class="r-in"><span><span class="co"># }</span></span></span> </code></pre></div> </div> </main><aside class="col-md-3"><nav id="toc" aria-label="Table of contents"><h2>On this page</h2> @@ -834,7 +837,7 @@ or according to Freundlich</p></dd> </div> <div class="pkgdown-footer-right"> - <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.1.3.</p> + <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.2.0.</p> </div> </footer></div> diff --git a/docs/reference/chent.md b/docs/reference/chent.md new file mode 100644 index 0000000..40716ce --- /dev/null +++ b/docs/reference/chent.md @@ -0,0 +1,802 @@ +# An R6 class for chemical entities with associated data + +The class is initialised with an identifier. Chemical information is +retrieved from the internet. Additionally, it can be generated using +RDKit if RDKit and its python bindings are installed. + +## Format + +An [R6::R6Class](https://r6.r-lib.org/reference/R6Class.html) generator +object + +## Public fields + +- `identifier`: + + (`character(1)`) + The identifier that was used to initiate the object, with attribute + 'source' + +- `inchikey`: + + (`character(1)`) + InChI Key, with attribute 'source' + +- `smiles`: + + ([`character()`](https://rdrr.io/r/base/character.html)) + SMILES code(s), with attribute 'source' + +- `mw`: + + (`numeric(1)`) + Molecular weight, with attribute 'source' + +- `pubchem`: + + ([`list()`](https://rdrr.io/r/base/list.html)) + List of information retrieved from PubChem + +- `rdkit`: + + List of information obtained with RDKit + +- `mol`: + + \<rdkit.Chem.rdchem.Mol\> object + +- `svg`: + + SVG code + +- `Picture`: + + Graph as a + [grImport::Picture](https://rdrr.io/pkg/grImport/man/Picture-class.html) + object obtained using the grImport package + +- `Pict_font_size`: + + Font size as extracted from the intermediate PostScript file + +- `pdf_height`: + + Height of the MediaBox in the pdf after cropping + +- `p0`: + + Vapour pressure in Pa + +- `cwsat`: + + Water solubility in mg/L + +- `PUF`: + + Plant uptake factor + +- `chyaml`: + + List of information obtained from a YAML file + +- `TPs`: + + List of transformation products as chent objects + +- `transformations`: + + Data frame of observed transformations + +- `soil_degradation`: + + Dataframe of modelling DT50 values + +- `soil_ff`: + + Dataframe of formation fractions + +- `soil_sorption`: + + Dataframe of soil sorption data + +## Methods + +### Public methods + +- [`chent$new()`](#method-chent-new) + +- [`chent$try_pubchem()`](#method-chent-try_pubchem) + +- [`chent$get_pubchem()`](#method-chent-get_pubchem) + +- [`chent$get_rdkit()`](#method-chent-get_rdkit) + +- [`chent$get_chyaml()`](#method-chent-get_chyaml) + +- [`chent$add_p0()`](#method-chent-add_p0) + +- [`chent$add_cwsat()`](#method-chent-add_cwsat) + +- [`chent$add_PUF()`](#method-chent-add_PUF) + +- [`chent$add_TP()`](#method-chent-add_TP) + +- [`chent$add_transformation()`](#method-chent-add_transformation) + +- [`chent$add_soil_degradation()`](#method-chent-add_soil_degradation) + +- [`chent$add_soil_ff()`](#method-chent-add_soil_ff) + +- [`chent$add_soil_sorption()`](#method-chent-add_soil_sorption) + +- [`chent$pdf()`](#method-chent-pdf) + +- [`chent$png()`](#method-chent-png) + +- [`chent$emf()`](#method-chent-emf) + +- [`chent$clone()`](#method-chent-clone) + +------------------------------------------------------------------------ + +### Method `new()` + +Creates a new instance of this +[R6](https://r6.r-lib.org/reference/R6Class.html) class. + +#### Usage + + chent$new( + identifier, + smiles = NULL, + inchikey = NULL, + pubchem = TRUE, + pubchem_from = c("name", "smiles", "inchikey"), + rdkit = TRUE, + template = NULL, + chyaml = FALSE + ) + +#### Arguments + +- `identifier`: + + Identifier to be stored in the object + +- `smiles`: + + Optional user provided SMILES code + +- `inchikey`: + + Optional user provided InChI Key + +- `pubchem`: + + Should an attempt be made to retrieve chemical information from + PubChem via the webchem package? + +- `pubchem_from`: + + Possibility to select the argument that is used to query pubchem + +- `rdkit`: + + Should an attempt be made to retrieve chemical information from a + local rdkit installation via python and the reticulate package? + +- `template`: + + An optional SMILES code to be used as template for RDKit + +- `chyaml`: + + Should we look for a identifier.yaml file in the working directory? + +------------------------------------------------------------------------ + +### Method `try_pubchem()` + +Try to get chemical information from PubChem + +#### Usage + + chent$try_pubchem(query = self$identifier, from = "name") + +#### Arguments + +- `query`: + + Query string to be passed to + [get_cid](https://docs.ropensci.org/webchem/reference/get_cid.html) + +- `from`: + + Passed to + [get_cid](https://docs.ropensci.org/webchem/reference/get_cid.html) + +------------------------------------------------------------------------ + +### Method `get_pubchem()` + +Get chemical information from PubChem for a known PubChem CID + +#### Usage + + chent$get_pubchem(pubchem_cid) + +#### Arguments + +- `pubchem_cid`: + + CID + +------------------------------------------------------------------------ + +### Method `get_rdkit()` + +Get chemical information from RDKit if available + +#### Usage + + chent$get_rdkit(template = NULL) + +#### Arguments + +- `template`: + + An optional SMILES code to be used as template for RDKit + +------------------------------------------------------------------------ + +### Method `get_chyaml()` + +Obtain information from a YAML file + +#### Usage + + chent$get_chyaml( + repo = c("wd", "local", "web"), + chyaml = paste0(URLencode(self$identifier), ".yaml") + ) + +#### Arguments + +- `repo`: + + Should the file be looked for in the current working directory, a + local git repository under `~/git/chyaml`, or from the web (not + implemented). + +- `chyaml`: + + The filename to be looked for + +------------------------------------------------------------------------ + +### Method `add_p0()` + +Add a vapour pressure + +#### Usage + + chent$add_p0(p0, T = NA, source = NA, page = NA, remark = "") + +#### Arguments + +- `p0`: + + The vapour pressure in Pa + +- `T`: + + Temperature + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +- `remark`: + + A remark + +------------------------------------------------------------------------ + +### Method `add_cwsat()` + +Add a water solubility + +#### Usage + + chent$add_cwsat(cwsat, T = NA, pH = NA, source = NA, page = NA, remark = "") + +#### Arguments + +- `cwsat`: + + The water solubility in mg/L + +- `T`: + + Temperature + +- `pH`: + + pH value + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +- `remark`: + + A remark + +------------------------------------------------------------------------ + +### Method `add_PUF()` + +Add a plant uptake factor + +#### Usage + + chent$add_PUF( + PUF = 0, + source = "focus_generic_gw_2014", + page = 41, + remark = "Conservative default value" + ) + +#### Arguments + +- `PUF`: + + The plant uptake factor, a number between 0 and 1 + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +- `remark`: + + A remark + +------------------------------------------------------------------------ + +### Method `add_TP()` + +Add a transformation product to the internal list + +#### Usage + + chent$add_TP(x, smiles = NULL, pubchem = FALSE) + +#### Arguments + +- `x`: + + A chent object, or an identifier to generate a chent object + +- `smiles`: + + Optional user provided SMILES code + +- `pubchem`: + + Should chemical information be obtained from PubChem? + +------------------------------------------------------------------------ + +### Method `add_transformation()` + +Add a line in the internal dataframe holding observed transformations + +#### Usage + + chent$add_transformation( + study_type, + TP_identifier, + max_occurrence, + remark = "", + source = NA, + pages = NA + ) + +#### Arguments + +- `study_type`: + + A characterisation of the study type + +- `TP_identifier`: + + An identifier of one of the transformation products in `self$TPs` + +- `max_occurrence`: + + The maximum observed occurrence of the transformation product, + expressed as a fraction of the amount that would result from + stochiometric transformation + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `pages`: + + The pages from which the information was taken + +------------------------------------------------------------------------ + +### Method `add_soil_degradation()` + +Add a line in the internal dataframe holding modelling DT50 values + +#### Usage + + chent$add_soil_degradation( + soils, + DT50_mod, + DT50_mod_ref, + type = NA, + country = NA, + pH_orig = NA, + pH_medium = NA, + pH_H2O = NA, + perc_OC = NA, + temperature = NA, + moisture = NA, + category = "lab", + formulation = NA, + model = NA, + chi2 = NA, + remark = "", + source, + page = NA + ) + +#### Arguments + +- `soils`: + + Names of the soils + +- `DT50_mod`: + + The modelling DT50 in the sense of regulatory pesticide fate modelling + +- `DT50_mod_ref`: + + The normalised modelling DT50 in the sense of regulatory pesticide + fate modelling + +- `type`: + + The soil type + +- `country`: + + The country (mainly for field studies) + +- `pH_orig`: + + The pH stated in the study + +- `pH_medium`: + + The medium in which this pH was measured + +- `pH_H2O`: + + The pH extrapolated to pure water + +- `perc_OC`: + + The percentage of organic carbon in the soil + +- `temperature`: + + The temperature during the study in degrees Celsius + +- `moisture`: + + The moisture during the study + +- `category`: + + Is it a laboratory ('lab') or field study ('field') + +- `formulation`: + + Name of the formulation applied, if it was not the technical active + ingredient + +- `model`: + + The degradation model used for deriving `DT50_mod` + +- `chi2`: + + The relative error as defined in FOCUS kinetics + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +------------------------------------------------------------------------ + +### Method `add_soil_ff()` + +Add one or more formation fractions for degradation in soil + +#### Usage + + chent$add_soil_ff(target, soils, ff = 1, remark = "", source, page = NA) + +#### Arguments + +- `target`: + + The identifier(s) of the transformation product + +- `soils`: + + The soil name(s) in which the transformation was observed + +- `ff`: + + The formation fraction(s) + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +------------------------------------------------------------------------ + +### Method `add_soil_sorption()` + +Add soil sorption data + +#### Usage + + chent$add_soil_sorption( + soils, + Kf, + Kfoc, + N, + type = NA, + pH_orig = NA, + pH_medium = NA, + pH_H2O = NA, + perc_OC = NA, + perc_clay = NA, + CEC = NA, + remark = "", + source, + page = NA + ) + +#### Arguments + +- `soils`: + + Names of the soils + +- `Kf`: + + The sorption constant in L/kg, either linear (then `N` is 1) or + according to Freundlich + +- `Kfoc`: + + The constant from above, normalised to soil organic carbon + +- `N`: + + The Freundlich exponent + +- `type`: + + The soil type + +- `pH_orig`: + + The pH stated in the study + +- `pH_medium`: + + The medium in which this pH was measured + +- `pH_H2O`: + + The pH extrapolated to pure water + +- `perc_OC`: + + The percentage of organic carbon in the soil + +- `perc_clay`: + + The percentage of clay in the soil + +- `CEC`: + + The cation exchange capacity + +- `remark`: + + A remark + +- `source`: + + An acronym specifying the source of the information + +- `page`: + + The page from which the information was taken + +------------------------------------------------------------------------ + +### Method [`pdf()`](https://rdrr.io/r/grDevices/pdf.html) + +Write a PDF image of the structure + +#### Usage + + chent$pdf( + file = paste0(self$identifier, ".pdf"), + dir = "structures/pdf", + template = NULL + ) + +#### Arguments + +- `file`: + + The file to write to + +- `dir`: + + The directory to write the file to + +- `template`: + + An optional SMILES code to be used as template for RDKit + +------------------------------------------------------------------------ + +### Method [`png()`](https://rdrr.io/r/grDevices/png.html) + +Write a PNG image of the structure + +#### Usage + + chent$png( + file = paste0(self$identifier, ".png"), + dir = "structures/png", + antialias = "gray" + ) + +#### Arguments + +- `file`: + + The file to write to + +- `dir`: + + The directory to write the file to + +- `antialias`: + + Passed to [png](https://rdrr.io/r/grDevices/png.html) + +------------------------------------------------------------------------ + +### Method `emf()` + +Write an EMF image of the structure using +[emf](https://rdrr.io/pkg/devEMF/man/emf.html) + +#### Usage + + chent$emf(file = paste0(self$identifier, ".emf"), dir = "structures/emf") + +#### Arguments + +- `file`: + + The file to write to + +- `dir`: + + The directory to write the file to + +------------------------------------------------------------------------ + +### Method `clone()` + +The objects of this class are cloneable with this method. + +#### Usage + + chent$clone(deep = FALSE) + +#### Arguments + +- `deep`: + + Whether to make a deep clone. + +## Examples + +``` r +# Don't run examples per default, as PubChem may be unavailable +# \dontrun{ +caffeine <- chent$new("caffeine") +#> Querying PubChem for name caffeine ... +#> Get chemical information from RDKit using PubChem SMILES +#> CN1C=NC2=C1C(=O)N(C(=O)N2C)C +print(caffeine) +#> <chent> +#> Identifier $identifier caffeine +#> InChI Key $inchikey RYYVLZVUVIJVGH-UHFFFAOYSA-N +#> SMILES string $smiles: +#> PubChem +#> "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" +#> Molecular weight $mw: 194.2 +#> PubChem synonyms (up to 10): +#> [1] "caffeine" "58-08-2" +#> [3] "Guaranine" "1,3,7-Trimethylxanthine" +#> [5] "Methyltheobromine" "Theine" +#> [7] "Thein" "Cafeina" +#> [9] "Caffein" "Cafipel" +if (!is.null(caffeine$Picture)) { + plot(caffeine) +} + +oct <- chent$new("1-octanol", smiles = "CCCCCCCCO", pubchem = FALSE) +#> Get chemical information from RDKit using user SMILES +#> CCCCCCCCO +print(oct) +#> <chent> +#> Identifier $identifier 1-octanol +#> InChI Key $inchikey NA +#> SMILES string $smiles: +#> user +#> "CCCCCCCCO" +#> Molecular weight $mw: 130.2 +# } +``` diff --git a/docs/reference/draw_svg.chent.md b/docs/reference/draw_svg.chent.md new file mode 100644 index 0000000..7b43988 --- /dev/null +++ b/docs/reference/draw_svg.chent.md @@ -0,0 +1,37 @@ +# Draw SVG graph from a chent object using RDKit + +Draw SVG graph from a chent object using RDKit + +## Usage + +``` r +draw_svg.chent( + x, + width = 300, + height = 150, + filename = paste0(names(x$identifier), ".svg"), + subdir = "svg" +) +``` + +## Arguments + +- x: + + The chent object to be plotted + +- width: + + The desired width in pixels + +- height: + + The desired height in pixels + +- filename: + + The filename + +- subdir: + + The path to which the file should be written diff --git a/docs/reference/index.html b/docs/reference/index.html index a8a9c05..52b7cfb 100644 --- a/docs/reference/index.html +++ b/docs/reference/index.html @@ -36,8 +36,7 @@ - - </div><div class="section level2"> + <dl></dl></div><div class="section level2"> @@ -48,43 +47,50 @@ </dt> <dd>An R6 class for chemical entities with associated data</dd> - </dl><dl><dt> + + <dt> <code><a href="pai.html">pai</a></code> </dt> <dd>An R6 class for pesticidal active ingredients and associated data</dd> - </dl><dl><dt> + + <dt> <code><a href="ppp.html">ppp</a></code> </dt> <dd>R6 class for a plant protection product with at least one active ingredient</dd> - </dl><dl><dt> + + <dt> <code><a href="draw_svg.chent.html">draw_svg.chent()</a></code> </dt> <dd>Draw SVG graph from a chent object using RDKit</dd> - </dl><dl><dt> + + <dt> <code><a href="plot.chent.html">plot(<i><chent></i>)</a></code> </dt> <dd>Plot method for chent objects</dd> - </dl><dl><dt> + + <dt> <code><a href="print.chent.html">print(<i><chent></i>)</a></code> </dt> <dd>Printing method for chent objects</dd> - </dl><dl><dt> + + <dt> <code><a href="print.pai.html">print(<i><pai></i>)</a></code> </dt> <dd>Printing method for pai objects (pesticidal active ingredients)</dd> - </dl><dl><dt> + + <dt> <code><a href="print.ppp.html">print(<i><ppp></i>)</a></code> @@ -99,7 +105,7 @@ </div> <div class="pkgdown-footer-right"> - <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.1.3.</p> + <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.2.0.</p> </div> </footer></div> diff --git a/docs/reference/index.md b/docs/reference/index.md new file mode 100644 index 0000000..c927189 --- /dev/null +++ b/docs/reference/index.md @@ -0,0 +1,20 @@ +# Package index + +## R6 Class definitions and methods + +- [`chent`](https://pkgdown.jrwb.de/chents/reference/chent.md) : An R6 + class for chemical entities with associated data +- [`pai`](https://pkgdown.jrwb.de/chents/reference/pai.md) : An R6 class + for pesticidal active ingredients and associated data +- [`ppp`](https://pkgdown.jrwb.de/chents/reference/ppp.md) : R6 class + for a plant protection product with at least one active ingredient +- [`draw_svg.chent()`](https://pkgdown.jrwb.de/chents/reference/draw_svg.chent.md) + : Draw SVG graph from a chent object using RDKit +- [`plot(`*`<chent>`*`)`](https://pkgdown.jrwb.de/chents/reference/plot.chent.md) + : Plot method for chent objects +- [`print(`*`<chent>`*`)`](https://pkgdown.jrwb.de/chents/reference/print.chent.md) + : Printing method for chent objects +- [`print(`*`<pai>`*`)`](https://pkgdown.jrwb.de/chents/reference/print.pai.md) + : Printing method for pai objects (pesticidal active ingredients) +- [`print(`*`<ppp>`*`)`](https://pkgdown.jrwb.de/chents/reference/print.ppp.md) + : Printing method for ppp objects (plant protection products) diff --git a/docs/reference/pai.html b/docs/reference/pai.html index 25ca564..29f9368 100644 --- a/docs/reference/pai.html +++ b/docs/reference/pai.html @@ -184,7 +184,9 @@ and the reticulate package?</p></dd> <div class="section level2"> <h2 id="ref-examples">Examples<a class="anchor" aria-label="anchor" href="#ref-examples"></a></h2> - <div class="sourceCode"><pre class="sourceCode r"><code><span class="r-in"><span><span class="va">atr</span> <span class="op"><-</span> <span class="va">pai</span><span class="op">$</span><span class="fu">new</span><span class="op">(</span><span class="st">"atrazine"</span><span class="op">)</span></span></span> + <div class="sourceCode"><pre class="sourceCode r"><code><span class="r-in"><span><span class="co"># Don't run examples per default, as PubChem may be unavailable</span></span></span> +<span class="r-in"><span><span class="co"># \dontrun{</span></span></span> +<span class="r-in"><span><span class="va">atr</span> <span class="op"><-</span> <span class="va">pai</span><span class="op">$</span><span class="fu">new</span><span class="op">(</span><span class="st">"atrazine"</span><span class="op">)</span></span></span> <span class="r-msg co"><span class="r-pr">#></span> Querying BCPC for atrazine ...</span> <span class="r-msg co"><span class="r-pr">#></span> Querying PubChem for inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N ...</span> <span class="r-msg co"><span class="r-pr">#></span> Get chemical information from RDKit using PubChem SMILES</span> @@ -225,6 +227,7 @@ and the reticulate package?</p></dd> <span class="r-out co"><span class="r-pr">#></span> [1] "1-DECANOL" "Decan-1-ol" "Decyl alcohol" "112-30-1" </span> <span class="r-out co"><span class="r-pr">#></span> [5] "n-Decyl alcohol" "n-Decanol" "Capric alcohol" "Nonylcarbinol" </span> <span class="r-out co"><span class="r-pr">#></span> [9] "Antak" "Royaltac" </span> +<span class="r-in"><span><span class="co"># }</span></span></span> </code></pre></div> </div> </main><aside class="col-md-3"><nav id="toc" aria-label="Table of contents"><h2>On this page</h2> @@ -236,7 +239,7 @@ and the reticulate package?</p></dd> </div> <div class="pkgdown-footer-right"> - <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.1.3.</p> + <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.2.0.</p> </div> </footer></div> diff --git a/docs/reference/pai.md b/docs/reference/pai.md new file mode 100644 index 0000000..2291653 --- /dev/null +++ b/docs/reference/pai.md @@ -0,0 +1,187 @@ +# An R6 class for pesticidal active ingredients and associated data + +This class is derived from +[chent](https://pkgdown.jrwb.de/chents/reference/chent.md). It makes it +easy to create a +[chent](https://pkgdown.jrwb.de/chents/reference/chent.md) from the ISO +common name of a pesticide active ingredient, and additionally stores +the ISO name as well as the complete result of querying the BCPC +compendium using +[bcpc_query](https://docs.ropensci.org/webchem/reference/bcpc_query.html). + +## Format + +An [R6::R6Class](https://r6.r-lib.org/reference/R6Class.html) generator +object + +## Super class + +[`chents::chent`](https://pkgdown.jrwb.de/chents/reference/chent.md) -\> +`pai` + +## Public fields + +- `iso`: + + ISO common name of the active ingredient according to ISO 1750 + +- `bcpc`: + + Information retrieved from the BCPC compendium available online at + \<pesticidecompendium.bcpc.org\> + +## Methods + +### Public methods + +- [`pai$new()`](#method-pai-new) + +- [`pai$clone()`](#method-pai-clone) + +Inherited methods + +- [`chents::chent$add_PUF()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_PUF) +- [`chents::chent$add_TP()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_TP) +- [`chents::chent$add_cwsat()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_cwsat) +- [`chents::chent$add_p0()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_p0) +- [`chents::chent$add_soil_degradation()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_soil_degradation) +- [`chents::chent$add_soil_ff()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_soil_ff) +- [`chents::chent$add_soil_sorption()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_soil_sorption) +- [`chents::chent$add_transformation()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-add_transformation) +- [`chents::chent$emf()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-emf) +- [`chents::chent$get_chyaml()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-get_chyaml) +- [`chents::chent$get_pubchem()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-get_pubchem) +- [`chents::chent$get_rdkit()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-get_rdkit) +- [`chents::chent$pdf()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-pdf) +- [`chents::chent$png()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-png) +- [`chents::chent$try_pubchem()`](https://pkgdown.jrwb.de/chents/reference/chent.html#method-try_pubchem) + +------------------------------------------------------------------------ + +### Method `new()` + +Create a new pai object + +#### Usage + + pai$new( + iso, + identifier = iso, + smiles = NULL, + inchikey = NULL, + bcpc = TRUE, + pubchem = TRUE, + pubchem_from = "auto", + rdkit = TRUE, + template = NULL, + chyaml = FALSE + ) + +#### Arguments + +- `iso`: + + The ISO common name to be used in the query of the BCPC compendium + +- `identifier`: + + Alternative identifier used for querying pubchem + +- `smiles`: + + Optional user provided SMILES code + +- `inchikey`: + + Optional user provided InChI Key + +- `bcpc`: + + Should the BCPC compendium be queried? + +- `pubchem`: + + Should an attempt be made to retrieve chemical information from + PubChem via the webchem package? + +- `pubchem_from`: + + Possibility to select the argument that is used to query pubchem + +- `rdkit`: + + Should an attempt be made to retrieve chemical information from a + local rdkit installation via python and the reticulate package? + +- `template`: + + An optional SMILES code to be used as template for RDKit + +- `chyaml`: + + Should we look for a identifier.yaml file in the working + +------------------------------------------------------------------------ + +### Method `clone()` + +The objects of this class are cloneable with this method. + +#### Usage + + pai$clone(deep = FALSE) + +#### Arguments + +- `deep`: + + Whether to make a deep clone. + +## Examples + +``` r +# Don't run examples per default, as PubChem may be unavailable +# \dontrun{ +atr <- pai$new("atrazine") +#> Querying BCPC for atrazine ... +#> Querying PubChem for inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N ... +#> Get chemical information from RDKit using PubChem SMILES +#> CCNC1=NC(=NC(=N1)Cl)NC(C)C +print(atr) +#> <pai> with ISO common name $iso atrazine +#> <chent> +#> Identifier $identifier atrazine +#> InChI Key $inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N +#> SMILES string $smiles: +#> PubChem +#> "CCNC1=NC(=NC(=N1)Cl)NC(C)C" +#> Molecular weight $mw: 215.7 +#> PubChem synonyms (up to 10): +#> [1] "atrazine" "1912-24-9" "Gesaprim" "Aatrex" "Atranex" +#> [6] "Atrazin" "Oleogesaprim" "Atazinax" "Atrasine" "Chromozin" +if (!is.null(atr$Picture)) { + plot(atr) +} + +# We can also define pais that are not found on the BCPC site +decanol <- pai$new("1-Decanol") +#> Querying BCPC for 1-Decanol ... +#> Common name 1-Decanol is not known at the BCPC compendium, trying PubChem +#> Querying PubChem for name 1-Decanol ... +#> Get chemical information from RDKit using PubChem SMILES +#> CCCCCCCCCCO +print(decanol) +#> <pai> without ISO common name +#> <chent> +#> Identifier $identifier 1-Decanol +#> InChI Key $inchikey MWKFXSUHUHTGQN-UHFFFAOYSA-N +#> SMILES string $smiles: +#> PubChem +#> "CCCCCCCCCCO" +#> Molecular weight $mw: 158.3 +#> PubChem synonyms (up to 10): +#> [1] "1-DECANOL" "Decan-1-ol" "Decyl alcohol" "112-30-1" +#> [5] "n-Decyl alcohol" "n-Decanol" "Capric alcohol" "Nonylcarbinol" +#> [9] "Antak" "Royaltac" +# } +``` diff --git a/docs/reference/plot.chent.html b/docs/reference/plot.chent.html index 49f54b2..c33b732 100644 --- a/docs/reference/plot.chent.html +++ b/docs/reference/plot.chent.html @@ -7,7 +7,7 @@ <a class="navbar-brand me-2" href="../index.html">chents</a> - <small class="nav-text text-muted me-auto" data-bs-toggle="tooltip" data-bs-placement="bottom" title="">0.4.0</small> + <small class="nav-text text-muted me-auto" data-bs-toggle="tooltip" data-bs-placement="bottom" title="">0.4.1</small> <button class="navbar-toggler" type="button" data-bs-toggle="collapse" data-bs-target="#navbar" aria-controls="navbar" aria-expanded="false" aria-label="Toggle navigation"> @@ -58,9 +58,11 @@ <div class="section level2"> <h2 id="ref-examples">Examples<a class="anchor" aria-label="anchor" href="#ref-examples"></a></h2> - <div class="sourceCode"><pre class="sourceCode r"><code><span class="r-in"><span><span class="va">caffeine</span> <span class="op"><-</span> <span class="va"><a href="chent.html">chent</a></span><span class="op">$</span><span class="fu">new</span><span class="op">(</span><span class="st">"caffeine"</span><span class="op">)</span></span></span> -<span class="r-msg co"><span class="r-pr">#></span> PubChem:</span> -<span class="r-msg co"><span class="r-pr">#></span> Trying to get chemical information from RDKit using PubChem SMILES</span> + <div class="sourceCode"><pre class="sourceCode r"><code><span class="r-in"><span><span class="co"># Don't run examples per default, as PubChem may be unavailable</span></span></span> +<span class="r-in"><span><span class="co"># \dontrun{</span></span></span> +<span class="r-in"><span><span class="va">caffeine</span> <span class="op"><-</span> <span class="va"><a href="chent.html">chent</a></span><span class="op">$</span><span class="fu">new</span><span class="op">(</span><span class="st">"caffeine"</span><span class="op">)</span></span></span> +<span class="r-msg co"><span class="r-pr">#></span> Querying PubChem for name caffeine ...</span> +<span class="r-msg co"><span class="r-pr">#></span> Get chemical information from RDKit using PubChem SMILES</span> <span class="r-msg co"><span class="r-pr">#></span> CN1C=NC2=C1C(=O)N(C(=O)N2C)C</span> <span class="r-in"><span><span class="fu"><a href="https://rdrr.io/r/base/print.html" class="external-link">print</a></span><span class="op">(</span><span class="va">caffeine</span><span class="op">)</span></span></span> <span class="r-out co"><span class="r-pr">#></span> <chent></span> @@ -75,11 +77,12 @@ <span class="r-out co"><span class="r-pr">#></span> [3] "Guaranine" "1,3,7-Trimethylxanthine"</span> <span class="r-out co"><span class="r-pr">#></span> [5] "Methyltheobromine" "Theine" </span> <span class="r-out co"><span class="r-pr">#></span> [7] "Thein" "Cafeina" </span> -<span class="r-out co"><span class="r-pr">#></span> [9] "Koffein" "Mateina" </span> +<span class="r-out co"><span class="r-pr">#></span> [9] "Caffein" "Cafipel" </span> <span class="r-in"><span><span class="kw">if</span> <span class="op">(</span><span class="op">!</span><span class="fu"><a href="https://rdrr.io/r/base/NULL.html" class="external-link">is.null</a></span><span class="op">(</span><span class="va">caffeine</span><span class="op">$</span><span class="va">Picture</span><span class="op">)</span><span class="op">)</span> <span class="op">{</span></span></span> <span class="r-in"><span> <span class="fu"><a href="https://rdrr.io/r/graphics/plot.default.html" class="external-link">plot</a></span><span class="op">(</span><span class="va">caffeine</span><span class="op">)</span></span></span> <span class="r-in"><span><span class="op">}</span></span></span> <span class="r-plt img"><img src="plot.chent-1.png" alt="" width="700" height="433"></span> +<span class="r-in"><span><span class="co"># }</span></span></span> </code></pre></div> </div> </main><aside class="col-md-3"><nav id="toc" aria-label="Table of contents"><h2>On this page</h2> @@ -91,7 +94,7 @@ </div> <div class="pkgdown-footer-right"> - <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.1.3.</p> + <p>Site built with <a href="https://pkgdown.r-lib.org/" class="external-link">pkgdown</a> 2.2.0.</p> </div> </footer></div> diff --git a/docs/reference/plot.chent.md b/docs/reference/plot.chent.md new file mode 100644 index 0000000..eaa6817 --- /dev/null +++ b/docs/reference/plot.chent.md @@ -0,0 +1,51 @@ +# Plot method for chent objects + +Plot method for chent objects + +## Usage + +``` r +# S3 method for class 'chent' +plot(x, ...) +``` + +## Arguments + +- x: + + The chent object to be plotted + +- ...: + + Further arguments passed to + [grImport::grid.picture](https://rdrr.io/pkg/grImport/man/grid.picture.html) + +## Examples + +``` r +# Don't run examples per default, as PubChem may be unavailable +# \dontrun{ +caffeine <- chent$new("caffeine") +#> Querying PubChem for name caffeine ... +#> Get chemical information from RDKit using PubChem SMILES +#> CN1C=NC2=C1C(=O)N(C(=O)N2C)C +print(caffeine) +#> <chent> +#> Identifier $identifier caffeine +#> InChI Key $inchikey RYYVLZVUVIJVGH-UHFFFAOYSA-N +#> SMILES string $smiles: +#> PubChem +#> "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" +#> Molecular weight $mw: 194.2 +#> PubChem synonyms (up to 10): +#> [1] "caffeine" "58-08-2" +#> [3] "Guaranine" "1,3,7-Trimethylxanthine" +#> [5] "Methyltheobromine" "Theine" +#> [7] "Thein" "Cafeina" +#> [9] "Caffein" "Cafipel" +if (!is.null(caffeine$Picture)) { + plot(caffeine) +} + +# } +``` diff --git a/docs/reference/ppp.md b/docs/reference/ppp.md new file mode 100644 index 0000000..77ff2b6 --- /dev/null +++ b/docs/reference/ppp.md @@ -0,0 +1,102 @@ +# R6 class for a plant protection product with at least one active ingredient + +Contains basic information about the active ingredients in the product + +## Format + +An [R6::R6Class](https://r6.r-lib.org/reference/R6Class.html) generator +object. + +## Public fields + +- `name`: + + The name of the product + +- `ais`: + + A list of active ingredients + +- `concentrations`: + + The concentration of the ais + +- `concentration_units`: + + Defaults to g/L + +- `density`: + + The density of the product + +- `density_units`: + + Defaults to g/L + +## Methods + +### Public methods + +- [`ppp$new()`](#method-ppp-new) + +- [`ppp$clone()`](#method-ppp-clone) + +------------------------------------------------------------------------ + +### Method `new()` + +Creates a new instance of this +[R6](https://r6.r-lib.org/reference/R6Class.html) class. + +#### Usage + + ppp$new( + name, + ..., + concentrations, + concentration_units = "g/L", + density = 1000, + density_units = "g/L" + ) + +#### Arguments + +- `name`: + + The name of the product + +- `...`: + + Identifiers of the active ingredients + +- `concentrations`: + + Concentrations of the active ingredients + +- `concentration_units`: + + Defaults to g/L + +- `density`: + + The density + +- `density_units`: + + Defaults to g/L + +------------------------------------------------------------------------ + +### Method `clone()` + +The objects of this class are cloneable with this method. + +#### Usage + + ppp$clone(deep = FALSE) + +#### Arguments + +- `deep`: + + Whether to make a deep clone. diff --git a/docs/reference/print.chent.md b/docs/reference/print.chent.md new file mode 100644 index 0000000..f4d84bf --- /dev/null +++ b/docs/reference/print.chent.md @@ -0,0 +1,20 @@ +# Printing method for chent objects + +Printing method for chent objects + +## Usage + +``` r +# S3 method for class 'chent' +print(x, ...) +``` + +## Arguments + +- x: + + The chent object to be printed + +- ...: + + Further arguments for compatibility with the S3 method diff --git a/docs/reference/print.pai.md b/docs/reference/print.pai.md new file mode 100644 index 0000000..86cad4b --- /dev/null +++ b/docs/reference/print.pai.md @@ -0,0 +1,20 @@ +# Printing method for pai objects (pesticidal active ingredients) + +Printing method for pai objects (pesticidal active ingredients) + +## Usage + +``` r +# S3 method for class 'pai' +print(x, ...) +``` + +## Arguments + +- x: + + The chent object to be printed + +- ...: + + Further arguments for compatibility with the S3 method diff --git a/docs/reference/print.ppp.md b/docs/reference/print.ppp.md new file mode 100644 index 0000000..8387a54 --- /dev/null +++ b/docs/reference/print.ppp.md @@ -0,0 +1,20 @@ +# Printing method for ppp objects (plant protection products) + +Printing method for ppp objects (plant protection products) + +## Usage + +``` r +# S3 method for class 'ppp' +print(x, ...) +``` + +## Arguments + +- x: + + The chent object to be printed + +- ...: + + Further arguments for compatibility with the S3 method |
